C24H22NPS — CID 24766068
diphenyl-[(2R)-2-(2-phenyl-1,3-thiazol-4-yl)propyl]phosphane (PubChem CID 24766068) has the molecular formula C24H22NPS and a molecular weight of 387.49 g/mol. Its IUPAC name is diphenyl-[(2R)-2-(2-phenyl-1,3-thiazol-4-yl)propyl]phosphane.
| Compound Name | diphenyl-[(2R)-2-(2-phenyl-1,3-thiazol-4-yl)propyl]phosphane |
|---|---|
| PubChem CID | 24766068 |
| Molecular Formula | C24H22NPS |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | diphenyl-[(2R)-2-(2-phenyl-1,3-thiazol-4-yl)propyl]phosphane |
| SMILES | C[C@@H](CP(c1ccccc1)c1ccccc1)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H22NPS/c1-19(23-18-27-24(25-23)20-11-5-2-6-12-20)17-26(21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,18-19H,17H2,1H3/t19-/m0/s1 |
| InChIKey | FQCQARPISSPHAK-IBGZPJMESA-N |
| XLogP | 6.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|