About CID 24766963
CID 24766963 (PubChem CID 24766963) has the molecular formula C9H7N2
and a molecular weight of 143.17 g/mol.
Molecular Properties
| Compound Name | CID 24766963 |
| PubChem CID | 24766963 |
| Molecular Formula | C9H7N2 |
| Molecular Weight | 143.17 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][N][C](c2ccccn2)[CH]1 |
| InChI | InChI=1S/C9H7N2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H |
| InChIKey | STIWXTXZWZKAPX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 26.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 24766963 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 24766963?
The IUPAC name of CID 24766963 (CID 24766963) is not available.
What is the SMILES notation for CID 24766963?
The canonical SMILES for CID 24766963 is [CH]1[CH][N][C](c2ccccn2)[CH]1.
What is the InChIKey of CID 24766963?
The InChIKey is STIWXTXZWZKAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N2/c1-2-6-10-8(4-1)9-5-3-7-11-9/h1-7H.
What are the key properties of CID 24766963?
CID 24766963 has a molecular weight of 143.17 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 24766963 is sourced from PubChem (CID 24766963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).