C24H28F2O4 — CID 24768950
(1R,2R,3S,4S,6R)-4-[4-cyclopropyl-3-[[4-(difluoromethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 24768950) has the molecular formula C24H28F2O4 and a molecular weight of 418.48 g/mol. Its IUPAC name is (1R,2R,3S,4S,6R)-4-[4-cyclopropyl-3-[[4-(difluoromethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2R,3S,4S,6R)-4-[4-cyclopropyl-3-[[4-(difluoromethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 24768950 |
| Molecular Formula | C24H28F2O4 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (1R,2R,3S,4S,6R)-4-[4-cyclopropyl-3-[[4-(difluoromethyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | OC[C@H]1C[C@@H](c2ccc(C3CC3)c(Cc3ccc(C(F)F)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H28F2O4/c25-24(26)15-3-1-13(2-4-15)9-17-10-16(7-8-19(17)14-5-6-14)20-11-18(12-27)21(28)23(30)22(20)29/h1-4,7-8,10,14,18,20-24,27-30H,5-6,9,11-12H2/t18-,20+,21-,22+,23+/m1/s1 |
| InChIKey | KJEWXZDOEVAAKX-GMISPTPDSA-N |
| XLogP | 3.27 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |