C26H34O5 — CID 24768952
(1R,2R,3S,4S,6R)-4-[4-cyclopropyl-3-[[4-(3-hydroxypropyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 24768952) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is (1R,2R,3S,4S,6R)-4-[4-cyclopropyl-3-[[4-(3-hydroxypropyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2R,3S,4S,6R)-4-[4-cyclopropyl-3-[[4-(3-hydroxypropyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 24768952 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (1R,2R,3S,4S,6R)-4-[4-cyclopropyl-3-[[4-(3-hydroxypropyl)phenyl]methyl]phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | OCCCc1ccc(Cc2cc([C@@H]3C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2C2CC2)cc1 |
| InChI | InChI=1S/C26H34O5/c27-11-1-2-16-3-5-17(6-4-16)12-20-13-19(9-10-22(20)18-7-8-18)23-14-21(15-28)24(29)26(31)25(23)30/h3-6,9-10,13,18,21,23-31H,1-2,7-8,11-12,14-15H2/t21-,23+,24-,25+,26+/m1/s1 |
| InChIKey | MBOSHNMVOKOCQZ-PKSHOOMXSA-N |
| XLogP | 2.26 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |