C29H33NO5 — CID 118084694
(1R,2R,3S,4S,6R)-4-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-(4-methylphenyl)phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 118084694) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is (1R,2R,3S,4S,6R)-4-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-(4-methylphenyl)phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2R,3S,4S,6R)-4-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-(4-methylphenyl)phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 118084694 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (1R,2R,3S,4S,6R)-4-[3-(3,4-dihydro-2H-1,4-benzoxazin-6-ylmethyl)-4-(4-methylphenyl)phenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | Cc1ccc(-c2ccc([C@@H]3C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2Cc2ccc3c(c2)NCCO3)cc1 |
| InChI | InChI=1S/C29H33NO5/c1-17-2-5-19(6-3-17)23-8-7-20(24-15-22(16-31)27(32)29(34)28(24)33)14-21(23)12-18-4-9-26-25(13-18)30-10-11-35-26/h2-9,13-14,22,24,27-34H,10-12,15-16H2,1H3/t22-,24+,27-,28+,29+/m1/s1 |
| InChIKey | DAJLMWKGJCLUEE-PEWSYWLXSA-N |
| XLogP | 3.24 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |