C24H30Cl2N6O3 — CID 24772625
(2S)-N-[N'-[[3,5-dichloro-4-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]carbamimidoyl]-1-(4-methoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 24772625) has the molecular formula C24H30Cl2N6O3 and a molecular weight of 521.45 g/mol. Its IUPAC name is (2S)-N-[N'-[[3,5-dichloro-4-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]carbamimidoyl]-1-(4-methoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[N'-[[3,5-dichloro-4-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]carbamimidoyl]-1-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24772625 |
| Molecular Formula | C24H30Cl2N6O3 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | (2S)-N-[N'-[[3,5-dichloro-4-[[2-(dimethylamino)acetyl]amino]phenyl]methyl]carbamimidoyl]-1-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(N2CCC[C@H]2C(=O)N/C(N)=N/Cc2cc(Cl)c(NC(=O)CN(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H30Cl2N6O3/c1-31(2)14-21(33)29-22-18(25)11-15(12-19(22)26)13-28-24(27)30-23(34)20-5-4-10-32(20)16-6-8-17(35-3)9-7-16/h6-9,11-12,20H,4-5,10,13-14H2,1-3H3,(H,29,33)(H3,27,28,30,34)/t20-/m0/s1 |
| InChIKey | BHYMGGCQSHAYDO-FQEVSTJZSA-N |
| XLogP | 3.10 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|