C9H12O2S2 — CID 24777605
1,3-dithian-2-yl(furan-2-yl)methanol (PubChem CID 24777605) has the molecular formula C9H12O2S2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1,3-dithian-2-yl(furan-2-yl)methanol.
| Compound Name | 1,3-dithian-2-yl(furan-2-yl)methanol |
|---|---|
| PubChem CID | 24777605 |
| Molecular Formula | C9H12O2S2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 1,3-dithian-2-yl(furan-2-yl)methanol |
| SMILES | OC(c1ccco1)C1SCCCS1 |
| InChI | InChI=1S/C9H12O2S2/c10-8(7-3-1-4-11-7)9-12-5-2-6-13-9/h1,3-4,8-10H,2,5-6H2 |
| InChIKey | RHPMHDNOLUHAHE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |