C37H74O7Si3 — CID 24788093
methyl (1R,2R,4S,5Z,7R,8S)-8-hydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undec-5-ene-8-carboxylate (PubChem CID 24788093) has the molecular formula C37H74O7Si3 and a molecular weight of 715.25 g/mol. Its IUPAC name is methyl (1R,2R,4S,5Z,7R,8S)-8-hydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undec-5-ene-8-carboxylate.
| Compound Name | methyl (1R,2R,4S,5Z,7R,8S)-8-hydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undec-5-ene-8-carboxylate |
|---|---|
| PubChem CID | 24788093 |
| Molecular Formula | C37H74O7Si3 |
| Molecular Weight | 715.25 g/mol |
| Exact Mass | 714.47 |
| IUPAC Name | methyl (1R,2R,4S,5Z,7R,8S)-8-hydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2S)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undec-5-ene-8-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@](C)(O[Si](CC)(CC)CC)[C@H]2CC[C@@](O)(C(=O)OC)[C@@H](/C=C\1[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)O2 |
| InChI | InChI=1S/C37H74O7Si3/c1-16-45(17-2,18-3)43-32-25-36(14,44-46(19-4,20-5)21-6)33-22-23-37(39,35(38)40-15)34(42-33)24-31(32)30(13)26-41-47(27(7)8,28(9)10)29(11)12/h24,27-30,32-34,39H,16-23,25-26H2,1-15H3/b31-24-/t30-,32+,33-,34-,36-,37+/m1/s1 |
| InChIKey | RJGORQRITFFTCJ-JHSLHEOCSA-N |
| XLogP | 9.77 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.25 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|