About 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one
1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one (PubChem CID 24789779) has the molecular formula C26H32N4O
and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one.
Molecular Properties
| Compound Name | 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one |
| PubChem CID | 24789779 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one |
| SMILES | CCCCn1c(-c2ccc(C(C)(C)C)cc2)nc2cc3[nH]c(=O)c(C(C)C)nc3cc21 |
| InChI | InChI=1S/C26H32N4O/c1-7-8-13-30-22-15-20-19(29-25(31)23(27-20)16(2)3)14-21(22)28-24(30)17-9-11-18(12-10-17)26(4,5)6/h9-12,14-16H,7-8,13H2,1-6H3,(H,29,31) |
| InChIKey | XXIGDKVSFIMVAO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one?
The IUPAC name of 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one (CID 24789779) is 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one.
What is the SMILES notation for 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one?
The canonical SMILES for 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one is CCCCn1c(-c2ccc(C(C)(C)C)cc2)nc2cc3[nH]c(=O)c(C(C)C)nc3cc21.
What is the InChIKey of 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one?
The InChIKey is XXIGDKVSFIMVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N4O/c1-7-8-13-30-22-15-20-19(29-25(31)23(27-20)16(2)3)14-21(22)28-24(30)17-9-11-18(12-10-17)26(4,5)6/h9-12,14-16H,7-8,13H2,1-6H3,(H,29,31).
What are the key properties of 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one?
1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one has a molecular weight of 416.57 g/mol, XLogP of 6.16, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-(4-tert-butylphenyl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one is sourced from PubChem (CID 24789779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).