C26H25N5O6 — CID 72948497
1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one (PubChem CID 72948497) has the molecular formula C26H25N5O6 and a molecular weight of 503.52 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one |
|---|---|
| PubChem CID | 72948497 |
| Molecular Formula | C26H25N5O6 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one |
| SMILES | COc1ccc(CCn2c(-c3ccc([N+](=O)[O-])o3)nc3cc4[nH]c(=O)c(C(C)C)nc4cc32)cc1OC |
| InChI | InChI=1S/C26H25N5O6/c1-14(2)24-26(32)29-16-12-18-19(13-17(16)27-24)30(25(28-18)21-7-8-23(37-21)31(33)34)10-9-15-5-6-20(35-3)22(11-15)36-4/h5-8,11-14H,9-10H2,1-4H3,(H,29,32) |
| InChIKey | GSERSEOCPPDLHH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|