C23H34O5 — CID 24798883
(1R,11R,15S)-15-hydroxy-4,5,7-trimethoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one (PubChem CID 24798883) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (1R,11R,15S)-15-hydroxy-4,5,7-trimethoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one.
| Compound Name | (1R,11R,15S)-15-hydroxy-4,5,7-trimethoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one |
|---|---|
| PubChem CID | 24798883 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (1R,11R,15S)-15-hydroxy-4,5,7-trimethoxy-12,12-dimethyl-6-propan-2-yltricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-9-one |
| SMILES | COc1c2c(c(OC)c(C(C)C)c1OC)C(=O)C[C@@H]1[C@@H](C2)[C@@H](O)CCC1(C)C |
| InChI | InChI=1S/C23H34O5/c1-12(2)18-21(27-6)19-14(20(26-5)22(18)28-7)10-13-15(11-17(19)25)23(3,4)9-8-16(13)24/h12-13,15-16,24H,8-11H2,1-7H3/t13-,15-,16+/m1/s1 |
| InChIKey | OFUQTMNIZMBYSP-BMFZPTHFSA-N |
| XLogP | 4.38 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |