C19H28N4O4 — CID 24799647
ditert-butyl 2-(4-aminophenyl)iminoimidazolidine-1,3-dicarboxylate (PubChem CID 24799647) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is ditert-butyl 2-(4-aminophenyl)iminoimidazolidine-1,3-dicarboxylate.
| Compound Name | ditert-butyl 2-(4-aminophenyl)iminoimidazolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 24799647 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | ditert-butyl 2-(4-aminophenyl)iminoimidazolidine-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C1=Nc1ccc(N)cc1 |
| InChI | InChI=1S/C19H28N4O4/c1-18(2,3)26-16(24)22-11-12-23(17(25)27-19(4,5)6)15(22)21-14-9-7-13(20)8-10-14/h7-10H,11-12,20H2,1-6H3 |
| InChIKey | YATWVZOOIJSCRX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|