C22H26N2O2 — CID 59637372
tert-butyl 2-(4-benzylphenyl)iminopyrrolidine-1-carboxylate (PubChem CID 59637372) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl 2-(4-benzylphenyl)iminopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-benzylphenyl)iminopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59637372 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl 2-(4-benzylphenyl)iminopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC/C1=N\c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-22(2,3)26-21(25)24-15-7-10-20(24)23-19-13-11-18(12-14-19)16-17-8-5-4-6-9-17/h4-6,8-9,11-14H,7,10,15-16H2,1-3H3/b23-20+ |
| InChIKey | IXBIVUCGCIOQPA-BSYVCWPDSA-N |
| XLogP | 5.34 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|