About tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate
tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate (PubChem CID 15262707) has the molecular formula C20H25NO2
and a molecular weight of 311.42 g/mol. Its IUPAC name is tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate |
| PubChem CID | 15262707 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate |
| SMILES | Cc1c2c(n(C(=O)OC(C)(C)C)c1Cc1ccccc1)CCC2 |
| InChI | InChI=1S/C20H25NO2/c1-14-16-11-8-12-17(16)21(19(22)23-20(2,3)4)18(14)13-15-9-6-5-7-10-15/h5-7,9-10H,8,11-13H2,1-4H3 |
| InChIKey | CHFMYGDJZPLWFW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate?
The IUPAC name of tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate (CID 15262707) is tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate.
What is the SMILES notation for tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate?
The canonical SMILES for tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate is Cc1c2c(n(C(=O)OC(C)(C)C)c1Cc1ccccc1)CCC2.
What is the InChIKey of tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate?
The InChIKey is CHFMYGDJZPLWFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO2/c1-14-16-11-8-12-17(16)21(19(22)23-20(2,3)4)18(14)13-15-9-6-5-7-10-15/h5-7,9-10H,8,11-13H2,1-4H3.
What are the key properties of tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate?
tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate has a molecular weight of 311.42 g/mol, XLogP of 4.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-benzyl-3-methyl-5,6-dihydro-4H-cyclopenta[b]pyrrole-1-carboxylate is sourced from PubChem (CID 15262707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).