C24H28N2O2 — CID 54121916
tert-butyl 2,5-dibenzyl-3H-diazepine-1-carboxylate (PubChem CID 54121916) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is tert-butyl 2,5-dibenzyl-3H-diazepine-1-carboxylate.
| Compound Name | tert-butyl 2,5-dibenzyl-3H-diazepine-1-carboxylate |
|---|---|
| PubChem CID | 54121916 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | tert-butyl 2,5-dibenzyl-3H-diazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC(Cc2ccccc2)=CCN1Cc1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-24(2,3)28-23(27)26-17-15-21(18-20-10-6-4-7-11-20)14-16-25(26)19-22-12-8-5-9-13-22/h4-15,17H,16,18-19H2,1-3H3 |
| InChIKey | NOHQWEYPPSFPGS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |