C19H21NO2 — CID 24807421
12-(2-hydroxyethyliminomethyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-ol (PubChem CID 24807421) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 12-(2-hydroxyethyliminomethyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-ol.
| Compound Name | 12-(2-hydroxyethyliminomethyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-ol |
|---|---|
| PubChem CID | 24807421 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 12-(2-hydroxyethyliminomethyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-ol |
| SMILES | OCC/N=C/c1cc2ccc1CCc1ccc(cc1O)CC2 |
| InChI | InChI=1S/C19H21NO2/c21-10-9-20-13-18-11-14-1-2-15-4-6-17(19(22)12-15)8-7-16(18)5-3-14/h3-6,11-13,21-22H,1-2,7-10H2/b20-13+ |
| InChIKey | JYFOGSOJFIPNTH-DEDYPNTBSA-N |
| XLogP | 2.69 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|