C21H19CuN3O2- — CID 5252203
copper(1+);2-(2-hydroxyethyliminomethyl)phenol;1,10-phenanthroline-1,10-diide (PubChem CID 5252203) has the molecular formula C21H19CuN3O2- and a molecular weight of 408.95 g/mol. Its IUPAC name is copper(1+);2-(2-hydroxyethyliminomethyl)phenol;1,10-phenanthroline-1,10-diide.
| Compound Name | copper(1+);2-(2-hydroxyethyliminomethyl)phenol;1,10-phenanthroline-1,10-diide |
|---|---|
| PubChem CID | 5252203 |
| Molecular Formula | C21H19CuN3O2- |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | copper(1+);2-(2-hydroxyethyliminomethyl)phenol;1,10-phenanthroline-1,10-diide |
| SMILES | C1=C[N-]c2c3c(ccc2=C1)=CC=C[N-]3.OCCN=Cc1ccccc1O.[Cu+] |
| InChI | InChI=1S/C12H8N2.C9H11NO2.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;11-6-5-10-7-8-3-1-2-4-9(8)12;/h1-8H;1-4,7,11-12H,5-6H2;/q-2;;+1 |
| InChIKey | CROBDZQZGBLXIN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|