C39H80O5Si3 — CID 24807928
(2R,3R)-2-[(2R,5R,7S)-8-[tert-butyl(dimethyl)silyl]oxy-5,7-bis[tri(propan-2-yl)silyloxy]octan-2-yl]-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 24807928) has the molecular formula C39H80O5Si3 and a molecular weight of 713.32 g/mol. Its IUPAC name is (2R,3R)-2-[(2R,5R,7S)-8-[tert-butyl(dimethyl)silyl]oxy-5,7-bis[tri(propan-2-yl)silyloxy]octan-2-yl]-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | (2R,3R)-2-[(2R,5R,7S)-8-[tert-butyl(dimethyl)silyl]oxy-5,7-bis[tri(propan-2-yl)silyloxy]octan-2-yl]-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 24807928 |
| Molecular Formula | C39H80O5Si3 |
| Molecular Weight | 713.32 g/mol |
| Exact Mass | 712.53 |
| IUPAC Name | (2R,3R)-2-[(2R,5R,7S)-8-[tert-butyl(dimethyl)silyl]oxy-5,7-bis[tri(propan-2-yl)silyloxy]octan-2-yl]-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | CC[C@@H]1C=CC(=O)O[C@@H]1[C@H](C)CC[C@H](C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C39H80O5Si3/c1-20-34-22-24-37(40)42-38(34)33(14)21-23-35(43-46(27(2)3,28(4)5)29(6)7)25-36(26-41-45(18,19)39(15,16)17)44-47(30(8)9,31(10)11)32(12)13/h22,24,27-36,38H,20-21,23,25-26H2,1-19H3/t33-,34-,35-,36+,38-/m1/s1 |
| InChIKey | GBENIEIBIHNWFJ-CARARZHISA-N |
| XLogP | 12.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.32 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|