C18H20O5 — CID 24808350
5-hydroxy-4,8-dipropyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione (PubChem CID 24808350) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 5-hydroxy-4,8-dipropyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione.
| Compound Name | 5-hydroxy-4,8-dipropyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
|---|---|
| PubChem CID | 24808350 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 5-hydroxy-4,8-dipropyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
| SMILES | CCCc1cc(=O)oc2c3c(cc(O)c12)OC(CCC)CC3=O |
| InChI | InChI=1S/C18H20O5/c1-3-5-10-7-15(21)23-18-16(10)13(20)9-14-17(18)12(19)8-11(22-14)6-4-2/h7,9,11,20H,3-6,8H2,1-2H3 |
| InChIKey | XZKRRPJQIDVYAF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|