C21H36O6 — CID 24809394
methyl 2-[(2R,6R)-4,4-dimethoxy-6-[[(2R,6S)-6-[(2S)-2-methylbut-3-enyl]oxan-2-yl]methyl]oxan-2-yl]acetate (PubChem CID 24809394) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is methyl 2-[(2R,6R)-4,4-dimethoxy-6-[[(2R,6S)-6-[(2S)-2-methylbut-3-enyl]oxan-2-yl]methyl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,6R)-4,4-dimethoxy-6-[[(2R,6S)-6-[(2S)-2-methylbut-3-enyl]oxan-2-yl]methyl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 24809394 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | methyl 2-[(2R,6R)-4,4-dimethoxy-6-[[(2R,6S)-6-[(2S)-2-methylbut-3-enyl]oxan-2-yl]methyl]oxan-2-yl]acetate |
| SMILES | C=C[C@@H](C)C[C@@H]1CCC[C@H](C[C@@H]2CC(OC)(OC)C[C@H](CC(=O)OC)O2)O1 |
| InChI | InChI=1S/C21H36O6/c1-6-15(2)10-16-8-7-9-17(26-16)11-18-13-21(24-4,25-5)14-19(27-18)12-20(22)23-3/h6,15-19H,1,7-14H2,2-5H3/t15-,16+,17-,18-,19+/m1/s1 |
| InChIKey | NIRSRPUCWBQLCU-ZRSRNVLSSA-N |
| XLogP | 3.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|