C29H47NO3 — CID 24809843
(5Z,8Z)-N-[(2R)-1-hydroxypropan-2-yl]-11-[3-(2-methyloctan-2-yl)phenoxy]undeca-5,8-dienamide (PubChem CID 24809843) has the molecular formula C29H47NO3 and a molecular weight of 457.70 g/mol. Its IUPAC name is (5Z,8Z)-N-[(2R)-1-hydroxypropan-2-yl]-11-[3-(2-methyloctan-2-yl)phenoxy]undeca-5,8-dienamide.
| Compound Name | (5Z,8Z)-N-[(2R)-1-hydroxypropan-2-yl]-11-[3-(2-methyloctan-2-yl)phenoxy]undeca-5,8-dienamide |
|---|---|
| PubChem CID | 24809843 |
| Molecular Formula | C29H47NO3 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.36 |
| IUPAC Name | (5Z,8Z)-N-[(2R)-1-hydroxypropan-2-yl]-11-[3-(2-methyloctan-2-yl)phenoxy]undeca-5,8-dienamide |
| SMILES | CCCCCCC(C)(C)c1cccc(OCC/C=C\C/C=C\CCCC(=O)N[C@H](C)CO)c1 |
| InChI | InChI=1S/C29H47NO3/c1-5-6-7-15-21-29(3,4)26-18-17-19-27(23-26)33-22-16-13-11-9-8-10-12-14-20-28(32)30-25(2)24-31/h8,10-11,13,17-19,23,25,31H,5-7,9,12,14-16,20-22,24H2,1-4H3,(H,30,32)/b10-8-,13-11-/t25-/m1/s1 |
| InChIKey | AMYLHZCZJGVTFT-IGNCQIMGSA-N |
| XLogP | 6.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|