C18H20OS — CID 24828782
5-ethylsulfinyltricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene (PubChem CID 24828782) has the molecular formula C18H20OS and a molecular weight of 284.42 g/mol. Its IUPAC name is 5-ethylsulfinyltricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene.
| Compound Name | 5-ethylsulfinyltricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
|---|---|
| PubChem CID | 24828782 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 5-ethylsulfinyltricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
| SMILES | CCS(=O)c1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C18H20OS/c1-2-20(19)18-13-16-8-7-14-3-5-15(6-4-14)9-11-17(18)12-10-16/h3-6,10,12-13H,2,7-9,11H2,1H3 |
| InChIKey | XALLWHKKTUPOMU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |