C19H22 — CID 23525991
5-ethyl-11-methyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (PubChem CID 23525991) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 5-ethyl-11-methyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene.
| Compound Name | 5-ethyl-11-methyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
|---|---|
| PubChem CID | 23525991 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-ethyl-11-methyltricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| SMILES | CCc1cc2ccc1CCc1ccc(c(C)c1)CC2 |
| InChI | InChI=1S/C19H22/c1-3-17-13-16-5-9-18-8-4-15(12-14(18)2)6-10-19(17)11-7-16/h4,7-8,11-13H,3,5-6,9-10H2,1-2H3 |
| InChIKey | SWXAVCKUIXTJFD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |