C25H26O3S — CID 45049109
[1,1-dideuterio-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethyl] 4-methylbenzenesulfonate (PubChem CID 45049109) has the molecular formula C25H26O3S and a molecular weight of 408.56 g/mol. Its IUPAC name is [1,1-dideuterio-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethyl] 4-methylbenzenesulfonate.
| Compound Name | [1,1-dideuterio-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 45049109 |
| Molecular Formula | C25H26O3S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [1,1-dideuterio-2-(5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)ethyl] 4-methylbenzenesulfonate |
| SMILES | [2H]C([2H])(Cc1cc2ccc1CCc1ccc(cc1)CC2)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H26O3S/c1-19-2-14-25(15-3-19)29(26,27)28-17-16-24-18-22-9-8-20-4-6-21(7-5-20)10-12-23(24)13-11-22/h2-7,11,13-15,18H,8-10,12,16-17H2,1H3/i17D2 |
| InChIKey | ZEJZPWCZHDBLRT-FBCWWBABSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|