C30H42N2O2 — CID 24843015
[5-[[di(propan-2-yl)amino]methyl]-1,2,5-trimethyl-4-phenylpiperidin-4-yl] (E)-3-phenylprop-2-enoate (PubChem CID 24843015) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is [5-[[di(propan-2-yl)amino]methyl]-1,2,5-trimethyl-4-phenylpiperidin-4-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [5-[[di(propan-2-yl)amino]methyl]-1,2,5-trimethyl-4-phenylpiperidin-4-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 24843015 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | [5-[[di(propan-2-yl)amino]methyl]-1,2,5-trimethyl-4-phenylpiperidin-4-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC1CC(OC(=O)/C=C/c2ccccc2)(c2ccccc2)C(C)(CN(C(C)C)C(C)C)CN1C |
| InChI | InChI=1S/C30H42N2O2/c1-23(2)32(24(3)4)22-29(6)21-31(7)25(5)20-30(29,27-16-12-9-13-17-27)34-28(33)19-18-26-14-10-8-11-15-26/h8-19,23-25H,20-22H2,1-7H3/b19-18+ |
| InChIKey | ZCYHPDHEGHNLJS-VHEBQXMUSA-N |
| XLogP | 5.99 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|