C14H18O4 — CID 24851317
(1'S,3'R,4'R,6'S,7'S,11'R)-6'-ethenylspiro[1,3-dioxolane-2,8'-2-oxatricyclo[5.3.1.04,11]undec-9-ene]-3'-ol (PubChem CID 24851317) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is (1'S,3'R,4'R,6'S,7'S,11'R)-6'-ethenylspiro[1,3-dioxolane-2,8'-2-oxatricyclo[5.3.1.04,11]undec-9-ene]-3'-ol.
| Compound Name | (1'S,3'R,4'R,6'S,7'S,11'R)-6'-ethenylspiro[1,3-dioxolane-2,8'-2-oxatricyclo[5.3.1.04,11]undec-9-ene]-3'-ol |
|---|---|
| PubChem CID | 24851317 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | (1'S,3'R,4'R,6'S,7'S,11'R)-6'-ethenylspiro[1,3-dioxolane-2,8'-2-oxatricyclo[5.3.1.04,11]undec-9-ene]-3'-ol |
| SMILES | C=C[C@@H]1C[C@@H]2[C@@H]3[C@H]1C1(C=C[C@@H]3O[C@H]2O)OCCO1 |
| InChI | InChI=1S/C14H18O4/c1-2-8-7-9-11-10(18-13(9)15)3-4-14(12(8)11)16-5-6-17-14/h2-4,8-13,15H,1,5-7H2/t8-,9-,10+,11+,12+,13-/m1/s1 |
| InChIKey | IVXFDMDWQSHUAP-BSKUUZOQSA-N |
| XLogP | 1.07 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|