C14H27NO2SSi — CID 24858454
S-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] azetidine-1-carbothioate (PubChem CID 24858454) has the molecular formula C14H27NO2SSi and a molecular weight of 301.53 g/mol. Its IUPAC name is S-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] azetidine-1-carbothioate.
| Compound Name | S-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] azetidine-1-carbothioate |
|---|---|
| PubChem CID | 24858454 |
| Molecular Formula | C14H27NO2SSi |
| Molecular Weight | 301.53 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | S-[(2R)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] azetidine-1-carbothioate |
| SMILES | C=C[C@H](CO[Si](C)(C)C(C)(C)C)SC(=O)N1CCC1 |
| InChI | InChI=1S/C14H27NO2SSi/c1-7-12(18-13(16)15-9-8-10-15)11-17-19(5,6)14(2,3)4/h7,12H,1,8-11H2,2-6H3/t12-/m1/s1 |
| InChIKey | XSTKELHVOBSZDX-GFCCVEGCSA-N |
| XLogP | 4.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|