C19H21NO3 — CID 24858821
4-(4-methylpent-3-enyl)-6-(4-nitrophenyl)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 24858821) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-(4-methylpent-3-enyl)-6-(4-nitrophenyl)cyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 4-(4-methylpent-3-enyl)-6-(4-nitrophenyl)cyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 24858821 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 4-(4-methylpent-3-enyl)-6-(4-nitrophenyl)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CC(C)=CCCC1=CC=C(C=O)C(c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C19H21NO3/c1-14(2)4-3-5-15-6-7-17(13-21)19(12-15)16-8-10-18(11-9-16)20(22)23/h4,6-11,13,19H,3,5,12H2,1-2H3 |
| InChIKey | WKUMVHFBFFOGBN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|