C28H52O9Si — CID 24862256
methyl 2-[(2S,3S,4S,6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetate (PubChem CID 24862256) has the molecular formula C28H52O9Si and a molecular weight of 560.80 g/mol. Its IUPAC name is methyl 2-[(2S,3S,4S,6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3S,4S,6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 24862256 |
| Molecular Formula | C28H52O9Si |
| Molecular Weight | 560.80 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | methyl 2-[(2S,3S,4S,6S)-6-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypent-4-enyl]-3-methyl-4-[(2S,3R,4S,5R)-3,4,5-trimethoxyoxan-2-yl]oxyoxan-2-yl]acetate |
| SMILES | C=CC[C@H](C[C@@H]1C[C@H](O[C@@H]2OC[C@@H](OC)[C@H](OC)[C@H]2OC)[C@@H](C)[C@H](CC(=O)OC)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H52O9Si/c1-12-13-19(37-38(10,11)28(3,4)5)14-20-15-21(18(2)22(35-20)16-24(29)31-7)36-27-26(33-9)25(32-8)23(30-6)17-34-27/h12,18-23,25-27H,1,13-17H2,2-11H3/t18-,19-,20-,21+,22+,23-,25+,26-,27+/m1/s1 |
| InChIKey | SMYAXQXHHXCTMQ-YOVITONRSA-N |
| XLogP | 4.49 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|