C28H32N4O4S — CID 24895452
1-[4-[(2-benzoylphenyl)sulfamoyl]phenyl]-3-(3-piperidin-1-ylpropyl)urea (PubChem CID 24895452) has the molecular formula C28H32N4O4S and a molecular weight of 520.66 g/mol. Its IUPAC name is 1-[4-[(2-benzoylphenyl)sulfamoyl]phenyl]-3-(3-piperidin-1-ylpropyl)urea.
| Compound Name | 1-[4-[(2-benzoylphenyl)sulfamoyl]phenyl]-3-(3-piperidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 24895452 |
| Molecular Formula | C28H32N4O4S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 1-[4-[(2-benzoylphenyl)sulfamoyl]phenyl]-3-(3-piperidin-1-ylpropyl)urea |
| SMILES | O=C(NCCCN1CCCCC1)Nc1ccc(S(=O)(=O)Nc2ccccc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32N4O4S/c33-27(22-10-3-1-4-11-22)25-12-5-6-13-26(25)31-37(35,36)24-16-14-23(15-17-24)30-28(34)29-18-9-21-32-19-7-2-8-20-32/h1,3-6,10-17,31H,2,7-9,18-21H2,(H2,29,30,34) |
| InChIKey | KZLRUEFFWHYSAT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|