C24H18F3N3O2 — CID 24900234
4-cyano-N-[2-oxo-2-[[phenyl-[3-(trifluoromethyl)phenyl]methyl]amino]ethyl]benzamide (PubChem CID 24900234) has the molecular formula C24H18F3N3O2 and a molecular weight of 437.42 g/mol. Its IUPAC name is 4-cyano-N-[2-oxo-2-[[phenyl-[3-(trifluoromethyl)phenyl]methyl]amino]ethyl]benzamide.
| Compound Name | 4-cyano-N-[2-oxo-2-[[phenyl-[3-(trifluoromethyl)phenyl]methyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 24900234 |
| Molecular Formula | C24H18F3N3O2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 4-cyano-N-[2-oxo-2-[[phenyl-[3-(trifluoromethyl)phenyl]methyl]amino]ethyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)NCC(=O)NC(c2ccccc2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H18F3N3O2/c25-24(26,27)20-8-4-7-19(13-20)22(17-5-2-1-3-6-17)30-21(31)15-29-23(32)18-11-9-16(14-28)10-12-18/h1-13,22H,15H2,(H,29,32)(H,30,31) |
| InChIKey | CKNMXQZGBPJVGC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |