C15H17N5OS — CID 24970388
8-ethyl-9-oxo-N'-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide (PubChem CID 24970388) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is 8-ethyl-9-oxo-N'-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide.
| Compound Name | 8-ethyl-9-oxo-N'-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide |
|---|---|
| PubChem CID | 24970388 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 8-ethyl-9-oxo-N'-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide |
| SMILES | CCn1cnc2ccc3nc(/C(N)=N/C(C)C)sc3c2c1=O |
| InChI | InChI=1S/C15H17N5OS/c1-4-20-7-17-9-5-6-10-12(11(9)15(20)21)22-14(19-10)13(16)18-8(2)3/h5-8H,4H2,1-3H3,(H2,16,18) |
| InChIKey | JBGGTHOWDDUOMW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|