C14H26S — CID 24972398
(2E)-1-tert-butylsulfanyl-3,7-dimethylocta-2,6-diene (PubChem CID 24972398) has the molecular formula C14H26S and a molecular weight of 226.43 g/mol. Its IUPAC name is (2E)-1-tert-butylsulfanyl-3,7-dimethylocta-2,6-diene.
| Compound Name | (2E)-1-tert-butylsulfanyl-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 24972398 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (2E)-1-tert-butylsulfanyl-3,7-dimethylocta-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CSC(C)(C)C |
| InChI | InChI=1S/C14H26S/c1-12(2)8-7-9-13(3)10-11-15-14(4,5)6/h8,10H,7,9,11H2,1-6H3/b13-10+ |
| InChIKey | ZLJBWXDPVBDFPU-JLHYYAGUSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|