C17H11Cl2F3N4 — CID 24979711
2,6-dichloro-4-[8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-1-yl]aniline (PubChem CID 24979711) has the molecular formula C17H11Cl2F3N4 and a molecular weight of 399.20 g/mol. Its IUPAC name is 2,6-dichloro-4-[8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-1-yl]aniline.
| Compound Name | 2,6-dichloro-4-[8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-1-yl]aniline |
|---|---|
| PubChem CID | 24979711 |
| Molecular Formula | C17H11Cl2F3N4 |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2,6-dichloro-4-[8-(trifluoromethyl)-3,4-dihydropyrazino[1,2-b]indazol-1-yl]aniline |
| SMILES | Nc1c(Cl)cc(C2=NCCn3nc4cc(C(F)(F)F)ccc4c32)cc1Cl |
| InChI | InChI=1S/C17H11Cl2F3N4/c18-11-5-8(6-12(19)14(11)23)15-16-10-2-1-9(17(20,21)22)7-13(10)25-26(16)4-3-24-15/h1-2,5-7H,3-4,23H2 |
| InChIKey | HOQYGFFOKCYUIZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|