C7H7IO — CID 24999686
(1S,4S)-5-iodobicyclo[2.2.1]hept-5-en-2-one (PubChem CID 24999686) has the molecular formula C7H7IO and a molecular weight of 234.04 g/mol. Its IUPAC name is (1S,4S)-5-iodobicyclo[2.2.1]hept-5-en-2-one.
| Compound Name | (1S,4S)-5-iodobicyclo[2.2.1]hept-5-en-2-one |
|---|---|
| PubChem CID | 24999686 |
| Molecular Formula | C7H7IO |
| Molecular Weight | 234.04 g/mol |
| Exact Mass | 233.95 |
| IUPAC Name | (1S,4S)-5-iodobicyclo[2.2.1]hept-5-en-2-one |
| SMILES | O=C1C[C@@H]2C[C@H]1C=C2I |
| InChI | InChI=1S/C7H7IO/c8-6-2-5-1-4(6)3-7(5)9/h2,4-5H,1,3H2/t4-,5-/m0/s1 |
| InChIKey | DXSGJIFGFOIRQA-WHFBIAKZSA-N |
| XLogP | 1.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.04 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|