C9H8OS — CID 130036291
4-thiatricyclo[5.2.1.02,6]deca-2,5-dien-8-one (PubChem CID 130036291) has the molecular formula C9H8OS and a molecular weight of 164.23 g/mol. Its IUPAC name is 4-thiatricyclo[5.2.1.02,6]deca-2,5-dien-8-one.
| Compound Name | 4-thiatricyclo[5.2.1.02,6]deca-2,5-dien-8-one |
|---|---|
| PubChem CID | 130036291 |
| Molecular Formula | C9H8OS |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 4-thiatricyclo[5.2.1.02,6]deca-2,5-dien-8-one |
| SMILES | O=C1CC2CC1c1cscc12 |
| InChI | InChI=1S/C9H8OS/c10-9-2-5-1-6(9)8-4-11-3-7(5)8/h3-6H,1-2H2 |
| InChIKey | AEHOVMRXLJDDHY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |