C29H35N3O2S — CID 25006670
cyclohexyl-phenyl-[5-[[(3R)-3-phenylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]methanolate (PubChem CID 25006670) has the molecular formula C29H35N3O2S and a molecular weight of 489.69 g/mol. Its IUPAC name is cyclohexyl-phenyl-[5-[[(3R)-3-phenylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]methanolate.
| Compound Name | cyclohexyl-phenyl-[5-[[(3R)-3-phenylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]methanolate |
|---|---|
| PubChem CID | 25006670 |
| Molecular Formula | C29H35N3O2S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | cyclohexyl-phenyl-[5-[[(3R)-3-phenylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2,4-oxadiazol-3-yl]methanolate |
| SMILES | [O-]C(c1ccccc1)(c1noc(C[N+]23CCC(CC2)[C@@H](Sc2ccccc2)C3)n1)C1CCCCC1 |
| InChI | InChI=1S/C29H35N3O2S/c33-29(23-10-4-1-5-11-23,24-12-6-2-7-13-24)28-30-27(34-31-28)21-32-18-16-22(17-19-32)26(20-32)35-25-14-8-3-9-15-25/h1,3-5,8-11,14-15,22,24,26H,2,6-7,12-13,16-21H2/t22?,26-,29?,32?/m0/s1 |
| InChIKey | PAEBDVLAKMOPPU-WZCNPKLGSA-N |
| XLogP | 5.16 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|