C30H30BrFN2O2S — CID 44815184
[5-[[(3R)-3-(3-fluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-diphenylmethanol bromide (PubChem CID 44815184) has the molecular formula C30H30BrFN2O2S and a molecular weight of 581.55 g/mol. Its IUPAC name is [5-[[(3R)-3-(3-fluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-diphenylmethanol bromide.
| Compound Name | [5-[[(3R)-3-(3-fluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-diphenylmethanol bromide |
|---|---|
| PubChem CID | 44815184 |
| Molecular Formula | C30H30BrFN2O2S |
| Molecular Weight | 581.55 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | [5-[[(3R)-3-(3-fluorophenyl)sulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-diphenylmethanol bromide |
| SMILES | OC(c1ccccc1)(c1ccccc1)c1cc(C[N+]23CCC(CC2)[C@@H](Sc2cccc(F)c2)C3)on1.[Br-] |
| InChI | InChI=1S/C30H30FN2O2S.BrH/c31-25-12-7-13-27(18-25)36-28-21-33(16-14-22(28)15-17-33)20-26-19-29(32-35-26)30(34,23-8-3-1-4-9-23)24-10-5-2-6-11-24;/h1-13,18-19,22,28,34H,14-17,20-21H2;1H/q+1;/p-1/t22?,28-,33?;/m0./s1 |
| InChIKey | LLKIKRJMGZVCPS-VFLHXYEWSA-M |
| XLogP | 3.00 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|