C32H41FN2O7S — CID 87301141
(R)-cyclohexyl-[5-[[3-(3-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-phenylmethanol;2-hydroxyethanesulfonate (PubChem CID 87301141) has the molecular formula C32H41FN2O7S and a molecular weight of 616.75 g/mol. Its IUPAC name is (R)-cyclohexyl-[5-[[3-(3-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-phenylmethanol;2-hydroxyethanesulfonate.
| Compound Name | (R)-cyclohexyl-[5-[[3-(3-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-phenylmethanol;2-hydroxyethanesulfonate |
|---|---|
| PubChem CID | 87301141 |
| Molecular Formula | C32H41FN2O7S |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | (R)-cyclohexyl-[5-[[3-(3-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-phenylmethanol;2-hydroxyethanesulfonate |
| SMILES | O=S(=O)([O-])CCO.O[C@](c1ccccc1)(c1cc(C[N+]23CCC(CC2)C(Oc2cccc(F)c2)C3)on1)C1CCCCC1 |
| InChI | InChI=1S/C30H36FN2O3.C2H6O4S/c31-25-12-7-13-26(18-25)35-28-21-33(16-14-22(28)15-17-33)20-27-19-29(32-36-27)30(34,23-8-3-1-4-9-23)24-10-5-2-6-11-24;3-1-2-7(4,5)6/h1,3-4,7-9,12-13,18-19,22,24,28,34H,2,5-6,10-11,14-17,20-21H2;3H,1-2H2,(H,4,5,6)/q+1;/p-1/t22?,28?,30-,33?;/m0./s1 |
| InChIKey | PWAFVGLTSFBGSO-NDBBQMFISA-M |
| XLogP | 4.34 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|