C29H35FN3O3+ — CID 25007417
(R)-cyclohexyl-[5-[[(3R)-3-(4-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3,4-oxadiazol-2-yl]-phenylmethanol (PubChem CID 25007417) has the molecular formula C29H35FN3O3+ and a molecular weight of 492.62 g/mol. Its IUPAC name is (R)-cyclohexyl-[5-[[(3R)-3-(4-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3,4-oxadiazol-2-yl]-phenylmethanol.
| Compound Name | (R)-cyclohexyl-[5-[[(3R)-3-(4-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3,4-oxadiazol-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 25007417 |
| Molecular Formula | C29H35FN3O3+ |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | (R)-cyclohexyl-[5-[[(3R)-3-(4-fluorophenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3,4-oxadiazol-2-yl]-phenylmethanol |
| SMILES | O[C@](c1ccccc1)(c1nnc(C[N+]23CCC(CC2)[C@@H](Oc2ccc(F)cc2)C3)o1)C1CCCCC1 |
| InChI | InChI=1S/C29H35FN3O3/c30-24-11-13-25(14-12-24)35-26-19-33(17-15-21(26)16-18-33)20-27-31-32-28(36-27)29(34,22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1,3-4,7-8,11-14,21,23,26,34H,2,5-6,9-10,15-20H2/q+1/t21?,26-,29-,33?/m0/s1 |
| InChIKey | FMVKEGLQTNPIBP-RYZJMXJLSA-N |
| XLogP | 5.21 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|