C29H35N2O3+ — CID 25003828
(R)-cyclobutyl-phenyl-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]methanol (PubChem CID 25003828) has the molecular formula C29H35N2O3+ and a molecular weight of 459.61 g/mol. Its IUPAC name is (R)-cyclobutyl-phenyl-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]methanol.
| Compound Name | (R)-cyclobutyl-phenyl-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 25003828 |
| Molecular Formula | C29H35N2O3+ |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (R)-cyclobutyl-phenyl-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]methanol |
| SMILES | O[C@](c1ccccc1)(c1ncc(C[N+]23CCC(CC2)C(OCc2ccccc2)C3)o1)C1CCC1 |
| InChI | InChI=1S/C29H35N2O3/c32-29(25-12-7-13-25,24-10-5-2-6-11-24)28-30-18-26(34-28)19-31-16-14-23(15-17-31)27(20-31)33-21-22-8-3-1-4-9-22/h1-6,8-11,18,23,25,27,32H,7,12-17,19-21H2/q+1/t23?,27?,29-,31?/m0/s1 |
| InChIKey | VPMUGYMLBOLJEP-SEPJSLFXSA-N |
| XLogP | 5.04 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|