C31H31BrN2O3 — CID 74944875
9-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]fluoren-9-ol bromide (PubChem CID 74944875) has the molecular formula C31H31BrN2O3 and a molecular weight of 559.50 g/mol. Its IUPAC name is 9-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]fluoren-9-ol bromide.
| Compound Name | 9-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]fluoren-9-ol bromide |
|---|---|
| PubChem CID | 74944875 |
| Molecular Formula | C31H31BrN2O3 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 9-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]fluoren-9-ol bromide |
| SMILES | OC1(c2ncc(C[N+]34CCC(CC3)C(OCc3ccccc3)C4)o2)c2ccccc2-c2ccccc21.[Br-] |
| InChI | InChI=1S/C31H31N2O3.BrH/c34-31(27-12-6-4-10-25(27)26-11-5-7-13-28(26)31)30-32-18-24(36-30)19-33-16-14-23(15-17-33)29(20-33)35-21-22-8-2-1-3-9-22;/h1-13,18,23,29,34H,14-17,19-21H2;1H/q+1;/p-1 |
| InChIKey | XLLBHMPHGKCVNJ-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|