C31H39N2O2S+ — CID 25003100
(R)-cyclohexyl-phenyl-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-thiazol-2-yl]methanol (PubChem CID 25003100) has the molecular formula C31H39N2O2S+ and a molecular weight of 503.73 g/mol. Its IUPAC name is (R)-cyclohexyl-phenyl-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-thiazol-2-yl]methanol.
| Compound Name | (R)-cyclohexyl-phenyl-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 25003100 |
| Molecular Formula | C31H39N2O2S+ |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | (R)-cyclohexyl-phenyl-[5-[(3-phenylmethoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-thiazol-2-yl]methanol |
| SMILES | O[C@](c1ccccc1)(c1ncc(C[N+]23CCC(CC2)C(OCc2ccccc2)C3)s1)C1CCCCC1 |
| InChI | InChI=1S/C31H39N2O2S/c34-31(26-12-6-2-7-13-26,27-14-8-3-9-15-27)30-32-20-28(36-30)21-33-18-16-25(17-19-33)29(22-33)35-23-24-10-4-1-5-11-24/h1-2,4-7,10-13,20,25,27,29,34H,3,8-9,14-19,21-23H2/q+1/t25?,29?,31-,33?/m0/s1 |
| InChIKey | LFSLODAUSWBCIO-OGFAXBPWSA-N |
| XLogP | 6.29 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|