C31H39N2O2S+ — CID 25005196
(R)-cyclohexyl-phenyl-[5-[[(3S)-3-(phenylsulfanylmethyl)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]methanol (PubChem CID 25005196) has the molecular formula C31H39N2O2S+ and a molecular weight of 503.73 g/mol. Its IUPAC name is (R)-cyclohexyl-phenyl-[5-[[(3S)-3-(phenylsulfanylmethyl)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]methanol.
| Compound Name | (R)-cyclohexyl-phenyl-[5-[[(3S)-3-(phenylsulfanylmethyl)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]methanol |
|---|---|
| PubChem CID | 25005196 |
| Molecular Formula | C31H39N2O2S+ |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | (R)-cyclohexyl-phenyl-[5-[[(3S)-3-(phenylsulfanylmethyl)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]methanol |
| SMILES | O[C@](c1ccccc1)(c1ncc(C[N+]23CCC(CC2)[C@H](CSc2ccccc2)C3)o1)C1CCCCC1 |
| InChI | InChI=1S/C31H39N2O2S/c34-31(26-10-4-1-5-11-26,27-12-6-2-7-13-27)30-32-20-28(35-30)22-33-18-16-24(17-19-33)25(21-33)23-36-29-14-8-3-9-15-29/h1,3-5,8-11,14-15,20,24-25,27,34H,2,6-7,12-13,16-19,21-23H2/q+1/t24?,25-,31-,33?/m0/s1 |
| InChIKey | DWQMLOIFKZRNBZ-QICMFAHVSA-N |
| XLogP | 6.64 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|