C31H38N2O2S — CID 25005201
(R)-[5-[[(3R)-3-benzylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanolate (PubChem CID 25005201) has the molecular formula C31H38N2O2S and a molecular weight of 502.72 g/mol. Its IUPAC name is (R)-[5-[[(3R)-3-benzylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanolate.
| Compound Name | (R)-[5-[[(3R)-3-benzylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanolate |
|---|---|
| PubChem CID | 25005201 |
| Molecular Formula | C31H38N2O2S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | (R)-[5-[[(3R)-3-benzylsulfanyl-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanolate |
| SMILES | [O-][C@](c1ccccc1)(c1ncc(C[N+]23CCC(CC2)[C@@H](SCc2ccccc2)C3)o1)C1CCCCC1 |
| InChI | InChI=1S/C31H38N2O2S/c34-31(26-12-6-2-7-13-26,27-14-8-3-9-15-27)30-32-20-28(35-30)21-33-18-16-25(17-19-33)29(22-33)36-23-24-10-4-1-5-11-24/h1-2,4-7,10-13,20,25,27,29H,3,8-9,14-19,21-23H2/t25?,29-,31-,33?/m0/s1 |
| InChIKey | CXNWJAPUWXIVSH-SGINLMEASA-N |
| XLogP | 5.90 |
| TPSA | 49.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|