C31H37ClN2O3 — CID 25007777
[5-[[(3S)-3-(3-chloro-4-methylphenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanolate (PubChem CID 25007777) has the molecular formula C31H37ClN2O3 and a molecular weight of 521.10 g/mol. Its IUPAC name is [5-[[(3S)-3-(3-chloro-4-methylphenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanolate.
| Compound Name | [5-[[(3S)-3-(3-chloro-4-methylphenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanolate |
|---|---|
| PubChem CID | 25007777 |
| Molecular Formula | C31H37ClN2O3 |
| Molecular Weight | 521.10 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | [5-[[(3S)-3-(3-chloro-4-methylphenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,3-oxazol-2-yl]-cyclohexyl-phenylmethanolate |
| SMILES | Cc1ccc(O[C@@H]2C[N+]3(Cc4cnc(C([O-])(c5ccccc5)C5CCCCC5)o4)CCC2CC3)cc1Cl |
| InChI | InChI=1S/C31H37ClN2O3/c1-22-12-13-26(18-28(22)32)36-29-21-34(16-14-23(29)15-17-34)20-27-19-33-30(37-27)31(35,24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2,4-5,8-9,12-13,18-19,23,25,29H,3,6-7,10-11,14-17,20-21H2,1H3/t23?,29-,31?,34?/m1/s1 |
| InChIKey | HJMDJHDJYZAGAS-MQKMZJFESA-N |
| XLogP | 6.01 |
| TPSA | 58.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.10 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|