C30H30N2O3 — CID 25002749
[5-[(3-phenoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]-diphenylmethanolate (PubChem CID 25002749) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is [5-[(3-phenoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]-diphenylmethanolate.
| Compound Name | [5-[(3-phenoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]-diphenylmethanolate |
|---|---|
| PubChem CID | 25002749 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | [5-[(3-phenoxy-1-azoniabicyclo[2.2.2]octan-1-yl)methyl]-1,3-oxazol-2-yl]-diphenylmethanolate |
| SMILES | [O-]C(c1ccccc1)(c1ccccc1)c1ncc(C[N+]23CCC(CC2)C(Oc2ccccc2)C3)o1 |
| InChI | InChI=1S/C30H30N2O3/c33-30(24-10-4-1-5-11-24,25-12-6-2-7-13-25)29-31-20-27(35-29)21-32-18-16-23(17-19-32)28(22-32)34-26-14-8-3-9-15-26/h1-15,20,23,28H,16-19,21-22H2 |
| InChIKey | HMRWNESXQUFNEC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|