C31H32FN2O3+ — CID 44816559
[5-[[(3R)-3-(4-fluoro-3-methylphenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-diphenylmethanol (PubChem CID 44816559) has the molecular formula C31H32FN2O3+ and a molecular weight of 499.61 g/mol. Its IUPAC name is [5-[[(3R)-3-(4-fluoro-3-methylphenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-diphenylmethanol.
| Compound Name | [5-[[(3R)-3-(4-fluoro-3-methylphenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 44816559 |
| Molecular Formula | C31H32FN2O3+ |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | [5-[[(3R)-3-(4-fluoro-3-methylphenoxy)-1-azoniabicyclo[2.2.2]octan-1-yl]methyl]-1,2-oxazol-3-yl]-diphenylmethanol |
| SMILES | Cc1cc(O[C@H]2C[N+]3(Cc4cc(C(O)(c5ccccc5)c5ccccc5)no4)CCC2CC3)ccc1F |
| InChI | InChI=1S/C31H32FN2O3/c1-22-18-26(12-13-28(22)32)36-29-21-34(16-14-23(29)15-17-34)20-27-19-30(33-37-27)31(35,24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-13,18-19,23,29,35H,14-17,20-21H2,1H3/q+1/t23?,29-,34?/m0/s1 |
| InChIKey | SVDZQFKXSNMTKW-NJVNTDJYSA-N |
| XLogP | 5.59 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|