C25H36O6 — CID 25013078
diethyl (3aZ,5E,8Z)-5-(2-ethoxy-2-oxoethylidene)-7-methyl-6-propyl-3,6,7,9a-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate (PubChem CID 25013078) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is diethyl (3aZ,5E,8Z)-5-(2-ethoxy-2-oxoethylidene)-7-methyl-6-propyl-3,6,7,9a-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate.
| Compound Name | diethyl (3aZ,5E,8Z)-5-(2-ethoxy-2-oxoethylidene)-7-methyl-6-propyl-3,6,7,9a-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 25013078 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | diethyl (3aZ,5E,8Z)-5-(2-ethoxy-2-oxoethylidene)-7-methyl-6-propyl-3,6,7,9a-tetrahydro-1H-cyclopenta[8]annulene-2,2-dicarboxylate |
| SMILES | CCCC1C(=C\C(=O)OCC)/C=C2/CC(C(=O)OCC)(C(=O)OCC)CC2/C=C\C1C |
| InChI | InChI=1S/C25H36O6/c1-6-10-21-17(5)11-12-18-15-25(23(27)30-8-3,24(28)31-9-4)16-20(18)13-19(21)14-22(26)29-7-2/h11-14,17-18,21H,6-10,15-16H2,1-5H3/b12-11-,19-14-,20-13- |
| InChIKey | FWKFLRUUXBYMCJ-DCWKAOIISA-N |
| XLogP | 4.55 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|