C9H18O3 — CID 25018189
(2S,3R)-1,2-dihydroxy-3,6-dimethylheptan-4-one (PubChem CID 25018189) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (2S,3R)-1,2-dihydroxy-3,6-dimethylheptan-4-one.
| Compound Name | (2S,3R)-1,2-dihydroxy-3,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 25018189 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (2S,3R)-1,2-dihydroxy-3,6-dimethylheptan-4-one |
| SMILES | CC(C)CC(=O)[C@H](C)[C@H](O)CO |
| InChI | InChI=1S/C9H18O3/c1-6(2)4-8(11)7(3)9(12)5-10/h6-7,9-10,12H,4-5H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | ULYFBHCVBWWHIV-IONNQARKSA-N |
| XLogP | 0.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |